C58H38F3N5 — CID 138555653
9-[2,6-bis(4,6-diphenylpyrimidin-2-yl)-4-(trifluoromethyl)phenyl]-3-(4-methylphenyl)carbazole (PubChem CID 138555653) has the molecular formula C58H38F3N5 and a molecular weight of 861.97 g/mol. Its IUPAC name is 9-[2,6-bis(4,6-diphenylpyrimidin-2-yl)-4-(trifluoromethyl)phenyl]-3-(4-methylphenyl)carbazole.
| Compound Name | 9-[2,6-bis(4,6-diphenylpyrimidin-2-yl)-4-(trifluoromethyl)phenyl]-3-(4-methylphenyl)carbazole |
|---|---|
| PubChem CID | 138555653 |
| Molecular Formula | C58H38F3N5 |
| Molecular Weight | 861.97 g/mol |
| Exact Mass | 861.31 |
| IUPAC Name | 9-[2,6-bis(4,6-diphenylpyrimidin-2-yl)-4-(trifluoromethyl)phenyl]-3-(4-methylphenyl)carbazole |
| SMILES | Cc1ccc(-c2ccc3c(c2)c2ccccc2n3-c2c(-c3nc(-c4ccccc4)cc(-c4ccccc4)n3)cc(C(F)(F)F)cc2-c2nc(-c3ccccc3)cc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C58H38F3N5/c1-37-26-28-38(29-27-37)43-30-31-54-46(32-43)45-24-14-15-25-53(45)66(54)55-47(56-62-49(39-16-6-2-7-17-39)35-50(63-56)40-18-8-3-9-19-40)33-44(58(59,60)61)34-48(55)57-64-51(41-20-10-4-11-21-41)36-52(65-57)42-22-12-5-13-23-42/h2-36H,1H3 |
| InChIKey | NCDGXZVRIBLRKS-UHFFFAOYSA-N |
| XLogP | 15.36 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 861.97 |
| LogP ≤ 5 | 15.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |