C66H41F3N8 — CID 138555508
9-[2,6-bis(2,6-diphenylpyrimidin-4-yl)-4-(trifluoromethyl)phenyl]-3-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazole (PubChem CID 138555508) has the molecular formula C66H41F3N8 and a molecular weight of 1003.10 g/mol. Its IUPAC name is 9-[2,6-bis(2,6-diphenylpyrimidin-4-yl)-4-(trifluoromethyl)phenyl]-3-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazole.
| Compound Name | 9-[2,6-bis(2,6-diphenylpyrimidin-4-yl)-4-(trifluoromethyl)phenyl]-3-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazole |
|---|---|
| PubChem CID | 138555508 |
| Molecular Formula | C66H41F3N8 |
| Molecular Weight | 1003.10 g/mol |
| Exact Mass | 1002.34 |
| IUPAC Name | 9-[2,6-bis(2,6-diphenylpyrimidin-4-yl)-4-(trifluoromethyl)phenyl]-3-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazole |
| SMILES | FC(F)(F)c1cc(-c2cc(-c3ccccc3)nc(-c3ccccc3)n2)c(-n2c3ccccc3c3cc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)ccc32)c(-c2cc(-c3ccccc3)nc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C66H41F3N8/c67-66(68,69)49-38-52(56-40-54(42-21-7-1-8-22-42)70-61(72-56)44-25-11-3-12-26-44)60(53(39-49)57-41-55(43-23-9-2-10-24-43)71-62(73-57)45-27-13-4-14-28-45)77-58-34-20-19-33-50(58)51-37-48(35-36-59(51)77)65-75-63(46-29-15-5-16-30-46)74-64(76-65)47-31-17-6-18-32-47/h1-41H |
| InChIKey | PAFPUZOVCLPYJX-UHFFFAOYSA-N |
| XLogP | 16.57 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1003.10 |
| LogP ≤ 5 | 16.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |