C67H48F3N5 — CID 156511562
9-[2,6-bis(2,6-diphenylpyrimidin-4-yl)-4-(trifluoromethyl)phenyl]-2,7-bis(3,5-dimethylphenyl)carbazole (PubChem CID 156511562) has the molecular formula C67H48F3N5 and a molecular weight of 980.15 g/mol. Its IUPAC name is 9-[2,6-bis(2,6-diphenylpyrimidin-4-yl)-4-(trifluoromethyl)phenyl]-2,7-bis(3,5-dimethylphenyl)carbazole.
| Compound Name | 9-[2,6-bis(2,6-diphenylpyrimidin-4-yl)-4-(trifluoromethyl)phenyl]-2,7-bis(3,5-dimethylphenyl)carbazole |
|---|---|
| PubChem CID | 156511562 |
| Molecular Formula | C67H48F3N5 |
| Molecular Weight | 980.15 g/mol |
| Exact Mass | 979.39 |
| IUPAC Name | 9-[2,6-bis(2,6-diphenylpyrimidin-4-yl)-4-(trifluoromethyl)phenyl]-2,7-bis(3,5-dimethylphenyl)carbazole |
| SMILES | Cc1cc(C)cc(-c2ccc3c4ccc(-c5cc(C)cc(C)c5)cc4n(-c4c(-c5cc(-c6ccccc6)nc(-c6ccccc6)n5)cc(C(F)(F)F)cc4-c4cc(-c5ccccc5)nc(-c5ccccc5)n4)c3c2)c1 |
| InChI | InChI=1S/C67H48F3N5/c1-41-29-42(2)32-51(31-41)49-25-27-54-55-28-26-50(52-33-43(3)30-44(4)34-52)36-63(55)75(62(54)35-49)64-56(60-39-58(45-17-9-5-10-18-45)71-65(73-60)47-21-13-7-14-22-47)37-53(67(68,69)70)38-57(64)61-40-59(46-19-11-6-12-20-46)72-66(74-61)48-23-15-8-16-24-48/h5-40H,1-4H3 |
| InChIKey | VAQVHNJVROKZEK-UHFFFAOYSA-N |
| XLogP | 17.95 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 980.15 |
| LogP ≤ 5 | 17.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |