C55H40F3N5 — CID 156511681
9-[2,6-bis(2,6-diphenylpyrimidin-4-yl)-4-(trifluoromethyl)phenyl]-2-tert-butylcarbazole (PubChem CID 156511681) has the molecular formula C55H40F3N5 and a molecular weight of 827.95 g/mol. Its IUPAC name is 9-[2,6-bis(2,6-diphenylpyrimidin-4-yl)-4-(trifluoromethyl)phenyl]-2-tert-butylcarbazole.
| Compound Name | 9-[2,6-bis(2,6-diphenylpyrimidin-4-yl)-4-(trifluoromethyl)phenyl]-2-tert-butylcarbazole |
|---|---|
| PubChem CID | 156511681 |
| Molecular Formula | C55H40F3N5 |
| Molecular Weight | 827.95 g/mol |
| Exact Mass | 827.32 |
| IUPAC Name | 9-[2,6-bis(2,6-diphenylpyrimidin-4-yl)-4-(trifluoromethyl)phenyl]-2-tert-butylcarbazole |
| SMILES | CC(C)(C)c1ccc2c3ccccc3n(-c3c(-c4cc(-c5ccccc5)nc(-c5ccccc5)n4)cc(C(F)(F)F)cc3-c3cc(-c4ccccc4)nc(-c4ccccc4)n3)c2c1 |
| InChI | InChI=1S/C55H40F3N5/c1-54(2,3)39-28-29-42-41-26-16-17-27-49(41)63(50(42)32-39)51-43(47-33-45(35-18-8-4-9-19-35)59-52(61-47)37-22-12-6-13-23-37)30-40(55(56,57)58)31-44(51)48-34-46(36-20-10-5-11-21-36)60-53(62-48)38-24-14-7-15-25-38/h4-34H,1-3H3 |
| InChIKey | LYWUQXBZONJCGN-UHFFFAOYSA-N |
| XLogP | 14.68 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.95 |
| LogP ≤ 5 | 14.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |