C59H48F3N5 — CID 156511388
9-[2,6-bis(2,6-diphenylpyrimidin-4-yl)-4-(trifluoromethyl)phenyl]-2,7-ditert-butylcarbazole (PubChem CID 156511388) has the molecular formula C59H48F3N5 and a molecular weight of 884.06 g/mol. Its IUPAC name is 9-[2,6-bis(2,6-diphenylpyrimidin-4-yl)-4-(trifluoromethyl)phenyl]-2,7-ditert-butylcarbazole.
| Compound Name | 9-[2,6-bis(2,6-diphenylpyrimidin-4-yl)-4-(trifluoromethyl)phenyl]-2,7-ditert-butylcarbazole |
|---|---|
| PubChem CID | 156511388 |
| Molecular Formula | C59H48F3N5 |
| Molecular Weight | 884.06 g/mol |
| Exact Mass | 883.39 |
| IUPAC Name | 9-[2,6-bis(2,6-diphenylpyrimidin-4-yl)-4-(trifluoromethyl)phenyl]-2,7-ditert-butylcarbazole |
| SMILES | CC(C)(C)c1ccc2c3ccc(C(C)(C)C)cc3n(-c3c(-c4cc(-c5ccccc5)nc(-c5ccccc5)n4)cc(C(F)(F)F)cc3-c3cc(-c4ccccc4)nc(-c4ccccc4)n3)c2c1 |
| InChI | InChI=1S/C59H48F3N5/c1-57(2,3)41-27-29-44-45-30-28-42(58(4,5)6)34-53(45)67(52(44)33-41)54-46(50-35-48(37-19-11-7-12-20-37)63-55(65-50)39-23-15-9-16-24-39)31-43(59(60,61)62)32-47(54)51-36-49(38-21-13-8-14-22-38)64-56(66-51)40-25-17-10-18-26-40/h7-36H,1-6H3 |
| InChIKey | AKAMPOSLDLACLY-UHFFFAOYSA-N |
| XLogP | 15.98 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 884.06 |
| LogP ≤ 5 | 15.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |