C53H30F3N7 — CID 158080457
9-[2-(2,6-diphenylpyrimidin-4-yl)-6-(4,6-diphenylpyrimidin-2-yl)-4-(trifluoromethyl)phenyl]-7-isocyanocarbazole-2-carbonitrile (PubChem CID 158080457) has the molecular formula C53H30F3N7 and a molecular weight of 821.87 g/mol. Its IUPAC name is 9-[2-(2,6-diphenylpyrimidin-4-yl)-6-(4,6-diphenylpyrimidin-2-yl)-4-(trifluoromethyl)phenyl]-7-isocyanocarbazole-2-carbonitrile.
| Compound Name | 9-[2-(2,6-diphenylpyrimidin-4-yl)-6-(4,6-diphenylpyrimidin-2-yl)-4-(trifluoromethyl)phenyl]-7-isocyanocarbazole-2-carbonitrile |
|---|---|
| PubChem CID | 158080457 |
| Molecular Formula | C53H30F3N7 |
| Molecular Weight | 821.87 g/mol |
| Exact Mass | 821.25 |
| IUPAC Name | 9-[2-(2,6-diphenylpyrimidin-4-yl)-6-(4,6-diphenylpyrimidin-2-yl)-4-(trifluoromethyl)phenyl]-7-isocyanocarbazole-2-carbonitrile |
| SMILES | [C-]#[N+]c1ccc2c3ccc(C#N)cc3n(-c3c(-c4cc(-c5ccccc5)nc(-c5ccccc5)n4)cc(C(F)(F)F)cc3-c3nc(-c4ccccc4)cc(-c4ccccc4)n3)c2c1 |
| InChI | InChI=1S/C53H30F3N7/c1-58-39-23-25-41-40-24-22-33(32-57)26-48(40)63(49(41)29-39)50-42(47-31-46(36-18-10-4-11-19-36)59-51(62-47)37-20-12-5-13-21-37)27-38(53(54,55)56)28-43(50)52-60-44(34-14-6-2-7-15-34)30-45(61-52)35-16-8-3-9-17-35/h2-31H |
| InChIKey | GCDOVFUOMBEVEZ-UHFFFAOYSA-N |
| XLogP | 13.81 |
| TPSA | 84.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.87 |
| LogP ≤ 5 | 13.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|