C52H31F3N6 — CID 156511431
9-[2,6-bis(4,6-diphenylpyrimidin-2-yl)-4-(trifluoromethyl)phenyl]carbazole-3-carbonitrile (PubChem CID 156511431) has the molecular formula C52H31F3N6 and a molecular weight of 796.86 g/mol. Its IUPAC name is 9-[2,6-bis(4,6-diphenylpyrimidin-2-yl)-4-(trifluoromethyl)phenyl]carbazole-3-carbonitrile.
| Compound Name | 9-[2,6-bis(4,6-diphenylpyrimidin-2-yl)-4-(trifluoromethyl)phenyl]carbazole-3-carbonitrile |
|---|---|
| PubChem CID | 156511431 |
| Molecular Formula | C52H31F3N6 |
| Molecular Weight | 796.86 g/mol |
| Exact Mass | 796.26 |
| IUPAC Name | 9-[2,6-bis(4,6-diphenylpyrimidin-2-yl)-4-(trifluoromethyl)phenyl]carbazole-3-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)c1ccccc1n2-c1c(-c2nc(-c3ccccc3)cc(-c3ccccc3)n2)cc(C(F)(F)F)cc1-c1nc(-c2ccccc2)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C52H31F3N6/c53-52(54,55)38-28-41(50-57-43(34-15-5-1-6-16-34)30-44(58-50)35-17-7-2-8-18-35)49(61-47-24-14-13-23-39(47)40-27-33(32-56)25-26-48(40)61)42(29-38)51-59-45(36-19-9-3-10-20-36)31-46(60-51)37-21-11-4-12-22-37/h1-31H |
| InChIKey | SHWHEGKMZUWWDV-UHFFFAOYSA-N |
| XLogP | 13.26 |
| TPSA | 80.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.86 |
| LogP ≤ 5 | 13.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |