C68H51N3 — CID 146281192
9-[2-(4-tert-butylphenyl)-6-phenyl-4-[2-phenyl-6-(4-phenylphenyl)pyrimidin-4-yl]phenyl]-3,6-diphenylcarbazole (PubChem CID 146281192) has the molecular formula C68H51N3 and a molecular weight of 910.18 g/mol. Its IUPAC name is 9-[2-(4-tert-butylphenyl)-6-phenyl-4-[2-phenyl-6-(4-phenylphenyl)pyrimidin-4-yl]phenyl]-3,6-diphenylcarbazole.
| Compound Name | 9-[2-(4-tert-butylphenyl)-6-phenyl-4-[2-phenyl-6-(4-phenylphenyl)pyrimidin-4-yl]phenyl]-3,6-diphenylcarbazole |
|---|---|
| PubChem CID | 146281192 |
| Molecular Formula | C68H51N3 |
| Molecular Weight | 910.18 g/mol |
| Exact Mass | 909.41 |
| IUPAC Name | 9-[2-(4-tert-butylphenyl)-6-phenyl-4-[2-phenyl-6-(4-phenylphenyl)pyrimidin-4-yl]phenyl]-3,6-diphenylcarbazole |
| SMILES | CC(C)(C)c1ccc(-c2cc(-c3cc(-c4ccc(-c5ccccc5)cc4)nc(-c4ccccc4)n3)cc(-c3ccccc3)c2-n2c3ccc(-c4ccccc4)cc3c3cc(-c4ccccc4)ccc32)cc1 |
| InChI | InChI=1S/C68H51N3/c1-68(2,3)57-37-33-51(34-38-57)59-44-56(63-45-62(69-67(70-63)53-27-17-8-18-28-53)52-31-29-49(30-32-52)46-19-9-4-10-20-46)43-58(50-25-15-7-16-26-50)66(59)71-64-39-35-54(47-21-11-5-12-22-47)41-60(64)61-42-55(36-40-65(61)71)48-23-13-6-14-24-48/h4-45H,1-3H3 |
| InChIKey | RJRGXPBSQGXOBM-UHFFFAOYSA-N |
| XLogP | 18.21 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 910.18 |
| LogP ≤ 5 | 18.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |