C51H38N4 — CID 146280891
6-tert-butyl-9-[4-(4,6-diphenylpyrimidin-2-yl)-2,6-diphenylphenyl]carbazole-3-carbonitrile (PubChem CID 146280891) has the molecular formula C51H38N4 and a molecular weight of 706.89 g/mol. Its IUPAC name is 6-tert-butyl-9-[4-(4,6-diphenylpyrimidin-2-yl)-2,6-diphenylphenyl]carbazole-3-carbonitrile.
| Compound Name | 6-tert-butyl-9-[4-(4,6-diphenylpyrimidin-2-yl)-2,6-diphenylphenyl]carbazole-3-carbonitrile |
|---|---|
| PubChem CID | 146280891 |
| Molecular Formula | C51H38N4 |
| Molecular Weight | 706.89 g/mol |
| Exact Mass | 706.31 |
| IUPAC Name | 6-tert-butyl-9-[4-(4,6-diphenylpyrimidin-2-yl)-2,6-diphenylphenyl]carbazole-3-carbonitrile |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C#N)ccc1n2-c1c(-c2ccccc2)cc(-c2nc(-c3ccccc3)cc(-c3ccccc3)n2)cc1-c1ccccc1 |
| InChI | InChI=1S/C51H38N4/c1-51(2,3)40-25-27-48-44(31-40)43-28-34(33-52)24-26-47(43)55(48)49-41(35-16-8-4-9-17-35)29-39(30-42(49)36-18-10-5-11-19-36)50-53-45(37-20-12-6-13-21-37)32-46(54-50)38-22-14-7-15-23-38/h4-32H,1-3H3 |
| InChIKey | XNFNWCRQAFVAOG-UHFFFAOYSA-N |
| XLogP | 13.08 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.89 |
| LogP ≤ 5 | 13.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |