C39H36N2 — CID 150303541
2-(3,6-ditert-butylcarbazol-9-yl)-3,5-diphenylbenzonitrile (PubChem CID 150303541) has the molecular formula C39H36N2 and a molecular weight of 532.73 g/mol. Its IUPAC name is 2-(3,6-ditert-butylcarbazol-9-yl)-3,5-diphenylbenzonitrile.
| Compound Name | 2-(3,6-ditert-butylcarbazol-9-yl)-3,5-diphenylbenzonitrile |
|---|---|
| PubChem CID | 150303541 |
| Molecular Formula | C39H36N2 |
| Molecular Weight | 532.73 g/mol |
| Exact Mass | 532.29 |
| IUPAC Name | 2-(3,6-ditert-butylcarbazol-9-yl)-3,5-diphenylbenzonitrile |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1c(C#N)cc(-c2ccccc2)cc1-c1ccccc1 |
| InChI | InChI=1S/C39H36N2/c1-38(2,3)30-17-19-35-33(23-30)34-24-31(39(4,5)6)18-20-36(34)41(35)37-29(25-40)21-28(26-13-9-7-10-14-26)22-32(37)27-15-11-8-12-16-27/h7-24H,1-6H3 |
| InChIKey | GKCRWQPXMIADQY-UHFFFAOYSA-N |
| XLogP | 10.58 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.73 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |