C54H38N4 — CID 118927648
2-(3-tert-butyl-6-phenylcarbazol-9-yl)-5-(6,9-diphenylcarbazol-2-yl)benzene-1,3-dicarbonitrile (PubChem CID 118927648) has the molecular formula C54H38N4 and a molecular weight of 742.93 g/mol. Its IUPAC name is 2-(3-tert-butyl-6-phenylcarbazol-9-yl)-5-(6,9-diphenylcarbazol-2-yl)benzene-1,3-dicarbonitrile.
| Compound Name | 2-(3-tert-butyl-6-phenylcarbazol-9-yl)-5-(6,9-diphenylcarbazol-2-yl)benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 118927648 |
| Molecular Formula | C54H38N4 |
| Molecular Weight | 742.93 g/mol |
| Exact Mass | 742.31 |
| IUPAC Name | 2-(3-tert-butyl-6-phenylcarbazol-9-yl)-5-(6,9-diphenylcarbazol-2-yl)benzene-1,3-dicarbonitrile |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(-c3ccccc3)ccc1n2-c1c(C#N)cc(-c2ccc3c4cc(-c5ccccc5)ccc4n(-c4ccccc4)c3c2)cc1C#N |
| InChI | InChI=1S/C54H38N4/c1-54(2,3)43-22-26-51-48(32-43)47-30-38(36-15-9-5-10-16-36)21-25-50(47)58(51)53-41(33-55)27-40(28-42(53)34-56)39-19-23-45-46-29-37(35-13-7-4-8-14-35)20-24-49(46)57(52(45)31-39)44-17-11-6-12-18-44/h4-32H,1-3H3 |
| InChIKey | RGDTZJPPGQAZDJ-UHFFFAOYSA-N |
| XLogP | 13.92 |
| TPSA | 57.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.93 |
| LogP ≤ 5 | 13.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |