C73H64N6 — CID 140704970
2,4-bis(3,6-ditert-butylcarbazol-9-yl)-6-(2,7-diphenylcarbazol-9-yl)-5-isocyanobenzene-1,3-dicarbonitrile (PubChem CID 140704970) has the molecular formula C73H64N6 and a molecular weight of 1025.36 g/mol. Its IUPAC name is 2,4-bis(3,6-ditert-butylcarbazol-9-yl)-6-(2,7-diphenylcarbazol-9-yl)-5-isocyanobenzene-1,3-dicarbonitrile.
| Compound Name | 2,4-bis(3,6-ditert-butylcarbazol-9-yl)-6-(2,7-diphenylcarbazol-9-yl)-5-isocyanobenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 140704970 |
| Molecular Formula | C73H64N6 |
| Molecular Weight | 1025.36 g/mol |
| Exact Mass | 1024.52 |
| IUPAC Name | 2,4-bis(3,6-ditert-butylcarbazol-9-yl)-6-(2,7-diphenylcarbazol-9-yl)-5-isocyanobenzene-1,3-dicarbonitrile |
| SMILES | [C-]#[N+]c1c(-n2c3ccc(C(C)(C)C)cc3c3cc(C(C)(C)C)ccc32)c(C#N)c(-n2c3ccc(C(C)(C)C)cc3c3cc(C(C)(C)C)ccc32)c(C#N)c1-n1c2cc(-c3ccccc3)ccc2c2ccc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C73H64N6/c1-70(2,3)48-26-32-60-54(38-48)55-39-49(71(4,5)6)27-33-61(55)77(60)67-58(42-74)68(78-62-34-28-50(72(7,8)9)40-56(62)57-41-51(73(10,11)12)29-35-63(57)78)66(76-13)69(59(67)43-75)79-64-36-46(44-20-16-14-17-21-44)24-30-52(64)53-31-25-47(37-65(53)79)45-22-18-15-19-23-45/h14-41H,1-12H3 |
| InChIKey | YTWSDDHCTDEPCO-UHFFFAOYSA-N |
| XLogP | 19.80 |
| TPSA | 66.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 79 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1025.36 |
| LogP ≤ 5 | 19.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|