C44H27N3 — CID 164835705
2-(3,6-diphenylcarbazol-9-yl)-3-isocyano-4,6-diphenylbenzonitrile (PubChem CID 164835705) has the molecular formula C44H27N3 and a molecular weight of 597.72 g/mol. Its IUPAC name is 2-(3,6-diphenylcarbazol-9-yl)-3-isocyano-4,6-diphenylbenzonitrile.
| Compound Name | 2-(3,6-diphenylcarbazol-9-yl)-3-isocyano-4,6-diphenylbenzonitrile |
|---|---|
| PubChem CID | 164835705 |
| Molecular Formula | C44H27N3 |
| Molecular Weight | 597.72 g/mol |
| Exact Mass | 597.22 |
| IUPAC Name | 2-(3,6-diphenylcarbazol-9-yl)-3-isocyano-4,6-diphenylbenzonitrile |
| SMILES | [C-]#[N+]c1c(-c2ccccc2)cc(-c2ccccc2)c(C#N)c1-n1c2ccc(-c3ccccc3)cc2c2cc(-c3ccccc3)ccc21 |
| InChI | InChI=1S/C44H27N3/c1-46-43-37(33-20-12-5-13-21-33)28-36(32-18-10-4-11-19-32)40(29-45)44(43)47-41-24-22-34(30-14-6-2-7-15-30)26-38(41)39-27-35(23-25-42(39)47)31-16-8-3-9-17-31/h2-28H |
| InChIKey | SZMYXYYTXMZOGI-UHFFFAOYSA-N |
| XLogP | 11.87 |
| TPSA | 33.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.72 |
| LogP ≤ 5 | 11.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|