C43H26N4 — CID 140705035
5-isocyano-2,3,4-triphenyl-6-(8-phenylpyrido[4,3-b]indol-5-yl)benzonitrile (PubChem CID 140705035) has the molecular formula C43H26N4 and a molecular weight of 598.71 g/mol. Its IUPAC name is 5-isocyano-2,3,4-triphenyl-6-(8-phenylpyrido[4,3-b]indol-5-yl)benzonitrile.
| Compound Name | 5-isocyano-2,3,4-triphenyl-6-(8-phenylpyrido[4,3-b]indol-5-yl)benzonitrile |
|---|---|
| PubChem CID | 140705035 |
| Molecular Formula | C43H26N4 |
| Molecular Weight | 598.71 g/mol |
| Exact Mass | 598.22 |
| IUPAC Name | 5-isocyano-2,3,4-triphenyl-6-(8-phenylpyrido[4,3-b]indol-5-yl)benzonitrile |
| SMILES | [C-]#[N+]c1c(-c2ccccc2)c(-c2ccccc2)c(-c2ccccc2)c(C#N)c1-n1c2ccncc2c2cc(-c3ccccc3)ccc21 |
| InChI | InChI=1S/C43H26N4/c1-45-42-41(32-20-12-5-13-21-32)40(31-18-10-4-11-19-31)39(30-16-8-3-9-17-30)35(27-44)43(42)47-37-23-22-33(29-14-6-2-7-15-29)26-34(37)36-28-46-25-24-38(36)47/h2-26,28H |
| InChIKey | XQNKTAMCQNKAQI-UHFFFAOYSA-N |
| XLogP | 11.27 |
| TPSA | 45.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.71 |
| LogP ≤ 5 | 11.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|