C32H28N4 — CID 140705042
3-isocyano-5-(2-methylhexan-2-yl)-2-(8-phenylpyrido[4,3-b]indol-5-yl)benzonitrile (PubChem CID 140705042) has the molecular formula C32H28N4 and a molecular weight of 468.60 g/mol. Its IUPAC name is 3-isocyano-5-(2-methylhexan-2-yl)-2-(8-phenylpyrido[4,3-b]indol-5-yl)benzonitrile.
| Compound Name | 3-isocyano-5-(2-methylhexan-2-yl)-2-(8-phenylpyrido[4,3-b]indol-5-yl)benzonitrile |
|---|---|
| PubChem CID | 140705042 |
| Molecular Formula | C32H28N4 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | 3-isocyano-5-(2-methylhexan-2-yl)-2-(8-phenylpyrido[4,3-b]indol-5-yl)benzonitrile |
| SMILES | [C-]#[N+]c1cc(C(C)(C)CCCC)cc(C#N)c1-n1c2ccncc2c2cc(-c3ccccc3)ccc21 |
| InChI | InChI=1S/C32H28N4/c1-5-6-15-32(2,3)25-17-24(20-33)31(28(19-25)34-4)36-29-13-12-23(22-10-8-7-9-11-22)18-26(29)27-21-35-16-14-30(27)36/h7-14,16-19,21H,5-6,15H2,1-3H3 |
| InChIKey | DGZJPGZZJPTHTC-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 45.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|