C45H26N4 — CID 140827081
4-[3-[3-(3,5-diphenylphenyl)phenyl]carbazol-9-yl]-5-isocyanobenzene-1,3-dicarbonitrile (PubChem CID 140827081) has the molecular formula C45H26N4 and a molecular weight of 622.73 g/mol. Its IUPAC name is 4-[3-[3-(3,5-diphenylphenyl)phenyl]carbazol-9-yl]-5-isocyanobenzene-1,3-dicarbonitrile.
| Compound Name | 4-[3-[3-(3,5-diphenylphenyl)phenyl]carbazol-9-yl]-5-isocyanobenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 140827081 |
| Molecular Formula | C45H26N4 |
| Molecular Weight | 622.73 g/mol |
| Exact Mass | 622.22 |
| IUPAC Name | 4-[3-[3-(3,5-diphenylphenyl)phenyl]carbazol-9-yl]-5-isocyanobenzene-1,3-dicarbonitrile |
| SMILES | [C-]#[N+]c1cc(C#N)cc(C#N)c1-n1c2ccccc2c2cc(-c3cccc(-c4cc(-c5ccccc5)cc(-c5ccccc5)c4)c3)ccc21 |
| InChI | InChI=1S/C45H26N4/c1-48-42-22-30(28-46)21-39(29-47)45(42)49-43-18-9-8-17-40(43)41-27-35(19-20-44(41)49)33-15-10-16-34(23-33)38-25-36(31-11-4-2-5-12-31)24-37(26-38)32-13-6-3-7-14-32/h2-27H |
| InChIKey | ZMRXNWDBOMPRRW-UHFFFAOYSA-N |
| XLogP | 11.75 |
| TPSA | 56.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.73 |
| LogP ≤ 5 | 11.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|