C78H45N9 — CID 158031666
4-[9-[2,6-bis(4-carbazol-9-ylphenyl)-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazol-3-yl]-5-isocyanobenzene-1,3-dicarbonitrile (PubChem CID 158031666) has the molecular formula C78H45N9 and a molecular weight of 1108.28 g/mol. Its IUPAC name is 4-[9-[2,6-bis(4-carbazol-9-ylphenyl)-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazol-3-yl]-5-isocyanobenzene-1,3-dicarbonitrile.
| Compound Name | 4-[9-[2,6-bis(4-carbazol-9-ylphenyl)-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazol-3-yl]-5-isocyanobenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 158031666 |
| Molecular Formula | C78H45N9 |
| Molecular Weight | 1108.28 g/mol |
| Exact Mass | 1107.38 |
| IUPAC Name | 4-[9-[2,6-bis(4-carbazol-9-ylphenyl)-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazol-3-yl]-5-isocyanobenzene-1,3-dicarbonitrile |
| SMILES | [C-]#[N+]c1cc(C#N)cc(C#N)c1-c1ccc2c(c1)c1ccccc1n2-c1c(-c2ccc(-n3c4ccccc4c4ccccc43)cc2)cc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)cc1-c1ccc(-n2c3ccccc3c3ccccc32)cc1 |
| InChI | InChI=1S/C78H45N9/c1-81-67-43-49(47-79)42-56(48-80)74(67)54-36-41-73-66(44-54)63-26-12-17-31-72(63)87(73)75-64(50-32-37-57(38-33-50)85-68-27-13-8-22-59(68)60-23-9-14-28-69(60)85)45-55(78-83-76(52-18-4-2-5-19-52)82-77(84-78)53-20-6-3-7-21-53)46-65(75)51-34-39-58(40-35-51)86-70-29-15-10-24-61(70)62-25-11-16-30-71(62)86/h2-46H |
| InChIKey | LWNZZEVUSRMBRR-UHFFFAOYSA-N |
| XLogP | 19.46 |
| TPSA | 105.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 87 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1108.28 |
| LogP ≤ 5 | 19.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|