C64H37N7 — CID 140810317
2-[3-[N-[9-(2,6-diisocyanophenyl)carbazol-3-yl]-4-[4-(4-phenylphenyl)phenyl]anilino]carbazol-9-yl]-3-isocyanobenzonitrile (PubChem CID 140810317) has the molecular formula C64H37N7 and a molecular weight of 904.05 g/mol. Its IUPAC name is 2-[3-[N-[9-(2,6-diisocyanophenyl)carbazol-3-yl]-4-[4-(4-phenylphenyl)phenyl]anilino]carbazol-9-yl]-3-isocyanobenzonitrile.
| Compound Name | 2-[3-[N-[9-(2,6-diisocyanophenyl)carbazol-3-yl]-4-[4-(4-phenylphenyl)phenyl]anilino]carbazol-9-yl]-3-isocyanobenzonitrile |
|---|---|
| PubChem CID | 140810317 |
| Molecular Formula | C64H37N7 |
| Molecular Weight | 904.05 g/mol |
| Exact Mass | 903.31 |
| IUPAC Name | 2-[3-[N-[9-(2,6-diisocyanophenyl)carbazol-3-yl]-4-[4-(4-phenylphenyl)phenyl]anilino]carbazol-9-yl]-3-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1cccc(C#N)c1-n1c2ccccc2c2cc(N(c3ccc(-c4ccc(-c5ccc(-c6ccccc6)cc5)cc4)cc3)c3ccc4c(c3)c3ccccc3n4-c3c([N+]#[C-])cccc3[N+]#[C-])ccc21 |
| InChI | InChI=1S/C64H37N7/c1-66-56-18-11-15-48(41-65)63(56)70-59-21-9-7-16-52(59)54-39-50(35-37-61(54)70)69(51-36-38-62-55(40-51)53-17-8-10-22-60(53)71(62)64-57(67-2)19-12-20-58(64)68-3)49-33-31-47(32-34-49)46-29-27-45(28-30-46)44-25-23-43(24-26-44)42-13-5-4-6-14-42/h4-40H |
| InChIKey | HAPLVIYJVRGCCH-UHFFFAOYSA-N |
| XLogP | 17.88 |
| TPSA | 49.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 904.05 |
| LogP ≤ 5 | 17.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|