C68H41N9 — CID 140779440
4-[6-[4-[4-[3,6-bis(N-phenylanilino)carbazol-9-yl]-3,5-diisocyanophenyl]phenyl]-2-(4-cyanophenyl)pyrimidin-4-yl]benzonitrile (PubChem CID 140779440) has the molecular formula C68H41N9 and a molecular weight of 984.14 g/mol. Its IUPAC name is 4-[6-[4-[4-[3,6-bis(N-phenylanilino)carbazol-9-yl]-3,5-diisocyanophenyl]phenyl]-2-(4-cyanophenyl)pyrimidin-4-yl]benzonitrile.
| Compound Name | 4-[6-[4-[4-[3,6-bis(N-phenylanilino)carbazol-9-yl]-3,5-diisocyanophenyl]phenyl]-2-(4-cyanophenyl)pyrimidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 140779440 |
| Molecular Formula | C68H41N9 |
| Molecular Weight | 984.14 g/mol |
| Exact Mass | 983.35 |
| IUPAC Name | 4-[6-[4-[4-[3,6-bis(N-phenylanilino)carbazol-9-yl]-3,5-diisocyanophenyl]phenyl]-2-(4-cyanophenyl)pyrimidin-4-yl]benzonitrile |
| SMILES | [C-]#[N+]c1cc(-c2ccc(-c3cc(-c4ccc(C#N)cc4)nc(-c4ccc(C#N)cc4)n3)cc2)cc([N+]#[C-])c1-n1c2ccc(N(c3ccccc3)c3ccccc3)cc2c2cc(N(c3ccccc3)c3ccccc3)ccc21 |
| InChI | InChI=1S/C68H41N9/c1-71-63-39-52(48-31-33-50(34-32-48)62-43-61(49-27-23-46(44-69)24-28-49)73-68(74-62)51-29-25-47(45-70)26-30-51)40-64(72-2)67(63)77-65-37-35-57(75(53-15-7-3-8-16-53)54-17-9-4-10-18-54)41-59(65)60-42-58(36-38-66(60)77)76(55-19-11-5-12-20-55)56-21-13-6-14-22-56/h3-43H |
| InChIKey | JKHDGIXCJZYJJG-UHFFFAOYSA-N |
| XLogP | 18.03 |
| TPSA | 93.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 984.14 |
| LogP ≤ 5 | 18.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|