C62H37N9 — CID 126734443
3-[6-[4-[3,6-bis(N-(4-cyanophenyl)anilino)carbazol-9-yl]phenyl]-2-(3-cyanophenyl)pyrimidin-4-yl]benzonitrile (PubChem CID 126734443) has the molecular formula C62H37N9 and a molecular weight of 908.04 g/mol. Its IUPAC name is 3-[6-[4-[3,6-bis(N-(4-cyanophenyl)anilino)carbazol-9-yl]phenyl]-2-(3-cyanophenyl)pyrimidin-4-yl]benzonitrile.
| Compound Name | 3-[6-[4-[3,6-bis(N-(4-cyanophenyl)anilino)carbazol-9-yl]phenyl]-2-(3-cyanophenyl)pyrimidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 126734443 |
| Molecular Formula | C62H37N9 |
| Molecular Weight | 908.04 g/mol |
| Exact Mass | 907.32 |
| IUPAC Name | 3-[6-[4-[3,6-bis(N-(4-cyanophenyl)anilino)carbazol-9-yl]phenyl]-2-(3-cyanophenyl)pyrimidin-4-yl]benzonitrile |
| SMILES | N#Cc1ccc(N(c2ccccc2)c2ccc3c(c2)c2cc(N(c4ccccc4)c4ccc(C#N)cc4)ccc2n3-c2ccc(-c3cc(-c4cccc(C#N)c4)nc(-c4cccc(C#N)c4)n3)cc2)cc1 |
| InChI | InChI=1S/C62H37N9/c63-38-42-17-23-51(24-18-42)69(49-13-3-1-4-14-49)54-29-31-60-56(35-54)57-36-55(70(50-15-5-2-6-16-50)52-25-19-43(39-64)20-26-52)30-32-61(57)71(60)53-27-21-46(22-28-53)58-37-59(47-11-7-9-44(33-47)40-65)68-62(67-58)48-12-8-10-45(34-48)41-66/h1-37H |
| InChIKey | QQFFOQCCAFQZIV-UHFFFAOYSA-N |
| XLogP | 15.00 |
| TPSA | 132.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 908.04 |
| LogP ≤ 5 | 15.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |