C61H37N7 — CID 140779783
4-[2-(4-cyanophenyl)-6-[4-[4-[3-isocyano-4-[3-(N-phenylanilino)carbazol-9-yl]phenyl]phenyl]phenyl]pyrimidin-4-yl]benzonitrile (PubChem CID 140779783) has the molecular formula C61H37N7 and a molecular weight of 868.02 g/mol. Its IUPAC name is 4-[2-(4-cyanophenyl)-6-[4-[4-[3-isocyano-4-[3-(N-phenylanilino)carbazol-9-yl]phenyl]phenyl]phenyl]pyrimidin-4-yl]benzonitrile.
| Compound Name | 4-[2-(4-cyanophenyl)-6-[4-[4-[3-isocyano-4-[3-(N-phenylanilino)carbazol-9-yl]phenyl]phenyl]phenyl]pyrimidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 140779783 |
| Molecular Formula | C61H37N7 |
| Molecular Weight | 868.02 g/mol |
| Exact Mass | 867.31 |
| IUPAC Name | 4-[2-(4-cyanophenyl)-6-[4-[4-[3-isocyano-4-[3-(N-phenylanilino)carbazol-9-yl]phenyl]phenyl]phenyl]pyrimidin-4-yl]benzonitrile |
| SMILES | [C-]#[N+]c1cc(-c2ccc(-c3ccc(-c4cc(-c5ccc(C#N)cc5)nc(-c5ccc(C#N)cc5)n4)cc3)cc2)ccc1-n1c2ccccc2c2cc(N(c3ccccc3)c3ccccc3)ccc21 |
| InChI | InChI=1S/C61H37N7/c1-64-57-36-49(32-34-60(57)68-58-15-9-8-14-53(58)54-37-52(33-35-59(54)68)67(50-10-4-2-5-11-50)51-12-6-3-7-13-51)45-26-24-43(25-27-45)44-28-30-47(31-29-44)56-38-55(46-20-16-41(39-62)17-21-46)65-61(66-56)48-22-18-42(40-63)19-23-48/h2-38H |
| InChIKey | VRZSVJULUXKISB-UHFFFAOYSA-N |
| XLogP | 15.67 |
| TPSA | 85.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 868.02 |
| LogP ≤ 5 | 15.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|