C59H39N5 — CID 140779758
9-[4-[4-[4-[2-(2-isocyanophenyl)-6-phenylpyrimidin-4-yl]phenyl]phenyl]phenyl]-N,N-diphenylcarbazol-3-amine (PubChem CID 140779758) has the molecular formula C59H39N5 and a molecular weight of 818.00 g/mol. Its IUPAC name is 9-[4-[4-[4-[2-(2-isocyanophenyl)-6-phenylpyrimidin-4-yl]phenyl]phenyl]phenyl]-N,N-diphenylcarbazol-3-amine.
| Compound Name | 9-[4-[4-[4-[2-(2-isocyanophenyl)-6-phenylpyrimidin-4-yl]phenyl]phenyl]phenyl]-N,N-diphenylcarbazol-3-amine |
|---|---|
| PubChem CID | 140779758 |
| Molecular Formula | C59H39N5 |
| Molecular Weight | 818.00 g/mol |
| Exact Mass | 817.32 |
| IUPAC Name | 9-[4-[4-[4-[2-(2-isocyanophenyl)-6-phenylpyrimidin-4-yl]phenyl]phenyl]phenyl]-N,N-diphenylcarbazol-3-amine |
| SMILES | [C-]#[N+]c1ccccc1-c1nc(-c2ccccc2)cc(-c2ccc(-c3ccc(-c4ccc(-n5c6ccccc6c6cc(N(c7ccccc7)c7ccccc7)ccc65)cc4)cc3)cc2)n1 |
| InChI | InChI=1S/C59H39N5/c1-60-54-23-13-11-22-52(54)59-61-55(45-15-5-2-6-16-45)40-56(62-59)46-31-29-43(30-32-46)41-25-27-42(28-26-41)44-33-35-49(36-34-44)64-57-24-14-12-21-51(57)53-39-50(37-38-58(53)64)63(47-17-7-3-8-18-47)48-19-9-4-10-20-48/h2-40H |
| InChIKey | ZRVLTGYBGNYDEU-UHFFFAOYSA-N |
| XLogP | 15.93 |
| TPSA | 38.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.00 |
| LogP ≤ 5 | 15.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|