C53H35N5 — CID 140922146
9-[3-(2,6-diphenylpyrimidin-4-yl)-5-(2-isocyanophenyl)phenyl]-N,N-diphenylcarbazol-2-amine (PubChem CID 140922146) has the molecular formula C53H35N5 and a molecular weight of 741.90 g/mol. Its IUPAC name is 9-[3-(2,6-diphenylpyrimidin-4-yl)-5-(2-isocyanophenyl)phenyl]-N,N-diphenylcarbazol-2-amine.
| Compound Name | 9-[3-(2,6-diphenylpyrimidin-4-yl)-5-(2-isocyanophenyl)phenyl]-N,N-diphenylcarbazol-2-amine |
|---|---|
| PubChem CID | 140922146 |
| Molecular Formula | C53H35N5 |
| Molecular Weight | 741.90 g/mol |
| Exact Mass | 741.29 |
| IUPAC Name | 9-[3-(2,6-diphenylpyrimidin-4-yl)-5-(2-isocyanophenyl)phenyl]-N,N-diphenylcarbazol-2-amine |
| SMILES | [C-]#[N+]c1ccccc1-c1cc(-c2cc(-c3ccccc3)nc(-c3ccccc3)n2)cc(-n2c3ccccc3c3ccc(N(c4ccccc4)c4ccccc4)cc32)c1 |
| InChI | InChI=1S/C53H35N5/c1-54-48-28-16-14-26-45(48)39-32-40(50-36-49(37-18-6-2-7-19-37)55-53(56-50)38-20-8-3-9-21-38)34-44(33-39)58-51-29-17-15-27-46(51)47-31-30-43(35-52(47)58)57(41-22-10-4-11-23-41)42-24-12-5-13-25-42/h2-36H |
| InChIKey | NFWDUCSKMIFDJD-UHFFFAOYSA-N |
| XLogP | 14.26 |
| TPSA | 38.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.90 |
| LogP ≤ 5 | 14.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|