C40H25N5 — CID 140922330
9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(2-isocyanophenyl)phenyl]carbazole (PubChem CID 140922330) has the molecular formula C40H25N5 and a molecular weight of 575.68 g/mol. Its IUPAC name is 9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(2-isocyanophenyl)phenyl]carbazole.
| Compound Name | 9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(2-isocyanophenyl)phenyl]carbazole |
|---|---|
| PubChem CID | 140922330 |
| Molecular Formula | C40H25N5 |
| Molecular Weight | 575.68 g/mol |
| Exact Mass | 575.21 |
| IUPAC Name | 9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(2-isocyanophenyl)phenyl]carbazole |
| SMILES | [C-]#[N+]c1ccccc1-c1cc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)cc(-n2c3ccccc3c3ccccc32)c1 |
| InChI | InChI=1S/C40H25N5/c1-41-35-21-11-8-18-32(35)29-24-30(26-31(25-29)45-36-22-12-9-19-33(36)34-20-10-13-23-37(34)45)40-43-38(27-14-4-2-5-15-27)42-39(44-40)28-16-6-3-7-17-28/h2-26H |
| InChIKey | HNILCFARHLVFJQ-UHFFFAOYSA-N |
| XLogP | 10.19 |
| TPSA | 47.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.68 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|