C35H20N6 — CID 140903292
9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,6-diisocyanophenyl]carbazole (PubChem CID 140903292) has the molecular formula C35H20N6 and a molecular weight of 524.59 g/mol. Its IUPAC name is 9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,6-diisocyanophenyl]carbazole.
| Compound Name | 9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,6-diisocyanophenyl]carbazole |
|---|---|
| PubChem CID | 140903292 |
| Molecular Formula | C35H20N6 |
| Molecular Weight | 524.59 g/mol |
| Exact Mass | 524.17 |
| IUPAC Name | 9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,6-diisocyanophenyl]carbazole |
| SMILES | [C-]#[N+]c1cc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)cc([N+]#[C-])c1-n1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C35H20N6/c1-36-28-21-25(35-39-33(23-13-5-3-6-14-23)38-34(40-35)24-15-7-4-8-16-24)22-29(37-2)32(28)41-30-19-11-9-17-26(30)27-18-10-12-20-31(27)41/h3-22H |
| InChIKey | CLPDXLNOECLCMU-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 52.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.59 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|