C76H47N7 — CID 162160384
9-[2,6-bis(3-carbazol-9-ylphenyl)-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-(3-isocyanophenyl)carbazole (PubChem CID 162160384) has the molecular formula C76H47N7 and a molecular weight of 1058.26 g/mol. Its IUPAC name is 9-[2,6-bis(3-carbazol-9-ylphenyl)-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-(3-isocyanophenyl)carbazole.
| Compound Name | 9-[2,6-bis(3-carbazol-9-ylphenyl)-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-(3-isocyanophenyl)carbazole |
|---|---|
| PubChem CID | 162160384 |
| Molecular Formula | C76H47N7 |
| Molecular Weight | 1058.26 g/mol |
| Exact Mass | 1057.39 |
| IUPAC Name | 9-[2,6-bis(3-carbazol-9-ylphenyl)-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-(3-isocyanophenyl)carbazole |
| SMILES | [C-]#[N+]c1cccc(-c2ccc3c(c2)c2ccccc2n3-c2c(-c3cccc(-n4c5ccccc5c5ccccc54)c3)cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc2-c2cccc(-n3c4ccccc4c4ccccc43)c2)c1 |
| InChI | InChI=1S/C76H47N7/c1-77-56-28-18-25-51(43-56)52-41-42-72-66(46-52)63-35-12-17-40-71(63)83(72)73-64(53-26-19-29-57(44-53)81-67-36-13-8-31-59(67)60-32-9-14-37-68(60)81)47-55(76-79-74(49-21-4-2-5-22-49)78-75(80-76)50-23-6-3-7-24-50)48-65(73)54-27-20-30-58(45-54)82-69-38-15-10-33-61(69)62-34-11-16-39-70(62)82/h2-48H |
| InChIKey | YFKBPSATPWQKAK-UHFFFAOYSA-N |
| XLogP | 19.72 |
| TPSA | 57.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 83 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1058.26 |
| LogP ≤ 5 | 19.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|