C81H53N5 — CID 146280568
3-carbazol-9-yl-9-[4-[4-(3,5-diphenylphenyl)-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]-2,6-diphenylphenyl]-6-phenylcarbazole (PubChem CID 146280568) has the molecular formula C81H53N5 and a molecular weight of 1096.35 g/mol. Its IUPAC name is 3-carbazol-9-yl-9-[4-[4-(3,5-diphenylphenyl)-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]-2,6-diphenylphenyl]-6-phenylcarbazole.
| Compound Name | 3-carbazol-9-yl-9-[4-[4-(3,5-diphenylphenyl)-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]-2,6-diphenylphenyl]-6-phenylcarbazole |
|---|---|
| PubChem CID | 146280568 |
| Molecular Formula | C81H53N5 |
| Molecular Weight | 1096.35 g/mol |
| Exact Mass | 1095.43 |
| IUPAC Name | 3-carbazol-9-yl-9-[4-[4-(3,5-diphenylphenyl)-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]-2,6-diphenylphenyl]-6-phenylcarbazole |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4cc(-c5ccccc5)cc(-c5ccccc5)c4)nc(-c4cc(-c5ccccc5)c(-n5c6ccc(-c7ccccc7)cc6c6cc(-n7c8ccccc8c8ccccc87)ccc65)c(-c5ccccc5)c4)n3)cc2)cc1 |
| InChI | InChI=1S/C81H53N5/c1-7-23-54(24-8-1)58-39-41-61(42-40-58)79-82-80(65-48-63(56-27-11-3-12-28-56)47-64(49-65)57-29-13-4-14-30-57)84-81(83-79)66-51-70(59-31-15-5-16-32-59)78(71(52-66)60-33-17-6-18-34-60)86-76-45-43-62(55-25-9-2-10-26-55)50-72(76)73-53-67(44-46-77(73)86)85-74-37-21-19-35-68(74)69-36-20-22-38-75(69)85/h1-53H |
| InChIKey | HVDKHTIHQMSEAV-UHFFFAOYSA-N |
| XLogP | 21.07 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 86 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1096.35 |
| LogP ≤ 5 | 21.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |