C52H31N7 — CID 177117289
9-[2,3-di(carbazol-9-yl)-4-isocyano-6-(4-phenyl-1,3,5-triazin-2-yl)phenyl]carbazole (PubChem CID 177117289) has the molecular formula C52H31N7 and a molecular weight of 753.87 g/mol. Its IUPAC name is 9-[2,3-di(carbazol-9-yl)-4-isocyano-6-(4-phenyl-1,3,5-triazin-2-yl)phenyl]carbazole.
| Compound Name | 9-[2,3-di(carbazol-9-yl)-4-isocyano-6-(4-phenyl-1,3,5-triazin-2-yl)phenyl]carbazole |
|---|---|
| PubChem CID | 177117289 |
| Molecular Formula | C52H31N7 |
| Molecular Weight | 753.87 g/mol |
| Exact Mass | 753.26 |
| IUPAC Name | 9-[2,3-di(carbazol-9-yl)-4-isocyano-6-(4-phenyl-1,3,5-triazin-2-yl)phenyl]carbazole |
| SMILES | [C-]#[N+]c1cc(-c2ncnc(-c3ccccc3)n2)c(-n2c3ccccc3c3ccccc32)c(-n2c3ccccc3c3ccccc32)c1-n1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C52H31N7/c1-53-41-31-40(52-55-32-54-51(56-52)33-17-3-2-4-18-33)48(57-42-25-11-5-19-34(42)35-20-6-12-26-43(35)57)50(59-46-29-15-9-23-38(46)39-24-10-16-30-47(39)59)49(41)58-44-27-13-7-21-36(44)37-22-8-14-28-45(37)58/h2-32H |
| InChIKey | RXBVSKLXXRQATJ-UHFFFAOYSA-N |
| XLogP | 13.05 |
| TPSA | 57.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.87 |
| LogP ≤ 5 | 13.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|