C62H42N6 — CID 140779531
9-[4-[4-[4-[2,6-bis(2-isocyanophenyl)pyrimidin-4-yl]phenyl]phenyl]-2,6-dimethylphenyl]-N,N-diphenylcarbazol-3-amine (PubChem CID 140779531) has the molecular formula C62H42N6 and a molecular weight of 871.06 g/mol. Its IUPAC name is 9-[4-[4-[4-[2,6-bis(2-isocyanophenyl)pyrimidin-4-yl]phenyl]phenyl]-2,6-dimethylphenyl]-N,N-diphenylcarbazol-3-amine.
| Compound Name | 9-[4-[4-[4-[2,6-bis(2-isocyanophenyl)pyrimidin-4-yl]phenyl]phenyl]-2,6-dimethylphenyl]-N,N-diphenylcarbazol-3-amine |
|---|---|
| PubChem CID | 140779531 |
| Molecular Formula | C62H42N6 |
| Molecular Weight | 871.06 g/mol |
| Exact Mass | 870.35 |
| IUPAC Name | 9-[4-[4-[4-[2,6-bis(2-isocyanophenyl)pyrimidin-4-yl]phenyl]phenyl]-2,6-dimethylphenyl]-N,N-diphenylcarbazol-3-amine |
| SMILES | [C-]#[N+]c1ccccc1-c1cc(-c2ccc(-c3ccc(-c4cc(C)c(-n5c6ccccc6c6cc(N(c7ccccc7)c7ccccc7)ccc65)c(C)c4)cc3)cc2)nc(-c2ccccc2[N+]#[C-])n1 |
| InChI | InChI=1S/C62H42N6/c1-41-37-47(38-42(2)61(41)68-59-26-16-13-21-51(59)54-39-50(35-36-60(54)68)67(48-17-7-5-8-18-48)49-19-9-6-10-20-49)45-29-27-43(28-30-45)44-31-33-46(34-32-44)57-40-58(52-22-11-14-24-55(52)63-3)66-62(65-57)53-23-12-15-25-56(53)64-4/h5-40H,1-2H3 |
| InChIKey | QAWPGACLLSTZSS-UHFFFAOYSA-N |
| XLogP | 17.10 |
| TPSA | 42.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.06 |
| LogP ≤ 5 | 17.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|