C29H26N4 — CID 140705058
4-(3,6-ditert-butylcarbazol-9-yl)-5-isocyanobenzene-1,3-dicarbonitrile (PubChem CID 140705058) has the molecular formula C29H26N4 and a molecular weight of 430.56 g/mol. Its IUPAC name is 4-(3,6-ditert-butylcarbazol-9-yl)-5-isocyanobenzene-1,3-dicarbonitrile.
| Compound Name | 4-(3,6-ditert-butylcarbazol-9-yl)-5-isocyanobenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 140705058 |
| Molecular Formula | C29H26N4 |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | 4-(3,6-ditert-butylcarbazol-9-yl)-5-isocyanobenzene-1,3-dicarbonitrile |
| SMILES | [C-]#[N+]c1cc(C#N)cc(C#N)c1-n1c2ccc(C(C)(C)C)cc2c2cc(C(C)(C)C)ccc21 |
| InChI | InChI=1S/C29H26N4/c1-28(2,3)20-8-10-25-22(14-20)23-15-21(29(4,5)6)9-11-26(23)33(25)27-19(17-31)12-18(16-30)13-24(27)32-7/h8-15H,1-6H3 |
| InChIKey | MVWBMJPTRYKZMA-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 56.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|