C52H38N4O2 — CID 153461992
2,3-bis(2-tert-butyl-[1]benzofuro[3,2-c]carbazol-5-yl)-4-isocyanobenzonitrile (PubChem CID 153461992) has the molecular formula C52H38N4O2 and a molecular weight of 750.90 g/mol. Its IUPAC name is 2,3-bis(2-tert-butyl-[1]benzofuro[3,2-c]carbazol-5-yl)-4-isocyanobenzonitrile.
| Compound Name | 2,3-bis(2-tert-butyl-[1]benzofuro[3,2-c]carbazol-5-yl)-4-isocyanobenzonitrile |
|---|---|
| PubChem CID | 153461992 |
| Molecular Formula | C52H38N4O2 |
| Molecular Weight | 750.90 g/mol |
| Exact Mass | 750.30 |
| IUPAC Name | 2,3-bis(2-tert-butyl-[1]benzofuro[3,2-c]carbazol-5-yl)-4-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1ccc(C#N)c(-n2c3ccc(C(C)(C)C)cc3c3c4oc5ccccc5c4ccc32)c1-n1c2ccc(C(C)(C)C)cc2c2c3oc4ccccc4c3ccc21 |
| InChI | InChI=1S/C52H38N4O2/c1-51(2,3)30-17-22-39-36(26-30)45-41(24-19-34-32-12-8-10-14-43(32)57-49(34)45)55(39)47-29(28-53)16-21-38(54-7)48(47)56-40-23-18-31(52(4,5)6)27-37(40)46-42(56)25-20-35-33-13-9-11-15-44(33)58-50(35)46/h8-27H,1-6H3 |
| InChIKey | PWCYUTPCSYYQGP-UHFFFAOYSA-N |
| XLogP | 14.70 |
| TPSA | 64.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.90 |
| LogP ≤ 5 | 14.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|