C26H13N3O — CID 153461916
2-([1]benzofuro[3,2-c]carbazol-5-yl)-3-isocyanobenzonitrile (PubChem CID 153461916) has the molecular formula C26H13N3O and a molecular weight of 383.41 g/mol. Its IUPAC name is 2-([1]benzofuro[3,2-c]carbazol-5-yl)-3-isocyanobenzonitrile.
| Compound Name | 2-([1]benzofuro[3,2-c]carbazol-5-yl)-3-isocyanobenzonitrile |
|---|---|
| PubChem CID | 153461916 |
| Molecular Formula | C26H13N3O |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 2-([1]benzofuro[3,2-c]carbazol-5-yl)-3-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1cccc(C#N)c1-n1c2ccccc2c2c3oc4ccccc4c3ccc21 |
| InChI | InChI=1S/C26H13N3O/c1-28-20-10-6-7-16(15-27)25(20)29-21-11-4-2-9-19(21)24-22(29)14-13-18-17-8-3-5-12-23(17)30-26(18)24/h2-14H |
| InChIKey | RUHROIDNHWIMNL-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 46.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|