C52H30N4O2 — CID 168824359
5-isocyano-2,4-bis(2-methyl-[1]benzofuro[3,2-c]carbazol-5-yl)-3-phenylbenzonitrile (PubChem CID 168824359) has the molecular formula C52H30N4O2 and a molecular weight of 742.84 g/mol. Its IUPAC name is 5-isocyano-2,4-bis(2-methyl-[1]benzofuro[3,2-c]carbazol-5-yl)-3-phenylbenzonitrile.
| Compound Name | 5-isocyano-2,4-bis(2-methyl-[1]benzofuro[3,2-c]carbazol-5-yl)-3-phenylbenzonitrile |
|---|---|
| PubChem CID | 168824359 |
| Molecular Formula | C52H30N4O2 |
| Molecular Weight | 742.84 g/mol |
| Exact Mass | 742.24 |
| IUPAC Name | 5-isocyano-2,4-bis(2-methyl-[1]benzofuro[3,2-c]carbazol-5-yl)-3-phenylbenzonitrile |
| SMILES | [C-]#[N+]c1cc(C#N)c(-n2c3ccc(C)cc3c3c4oc5ccccc5c4ccc32)c(-c2ccccc2)c1-n1c2ccc(C)cc2c2c3oc4ccccc4c3ccc21 |
| InChI | InChI=1S/C52H30N4O2/c1-29-17-21-40-37(25-29)47-42(23-19-35-33-13-7-9-15-44(33)57-51(35)47)55(40)49-32(28-53)27-39(54-3)50(46(49)31-11-5-4-6-12-31)56-41-22-18-30(2)26-38(41)48-43(56)24-20-36-34-14-8-10-16-45(34)58-52(36)48/h4-27H,1-2H3 |
| InChIKey | WNIAXXSXTHAQDZ-UHFFFAOYSA-N |
| XLogP | 14.39 |
| TPSA | 64.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.84 |
| LogP ≤ 5 | 14.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|