C72H44N6O2 — CID 156680198
2,5-bis([1]benzofuro[3,2-c]carbazol-5-yl)-4,6-bis(3,6-dimethylcarbazol-9-yl)-3-isocyanobenzonitrile (PubChem CID 156680198) has the molecular formula C72H44N6O2 and a molecular weight of 1025.18 g/mol. Its IUPAC name is 2,5-bis([1]benzofuro[3,2-c]carbazol-5-yl)-4,6-bis(3,6-dimethylcarbazol-9-yl)-3-isocyanobenzonitrile.
| Compound Name | 2,5-bis([1]benzofuro[3,2-c]carbazol-5-yl)-4,6-bis(3,6-dimethylcarbazol-9-yl)-3-isocyanobenzonitrile |
|---|---|
| PubChem CID | 156680198 |
| Molecular Formula | C72H44N6O2 |
| Molecular Weight | 1025.18 g/mol |
| Exact Mass | 1024.35 |
| IUPAC Name | 2,5-bis([1]benzofuro[3,2-c]carbazol-5-yl)-4,6-bis(3,6-dimethylcarbazol-9-yl)-3-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1c(-n2c3ccc(C)cc3c3cc(C)ccc32)c(-n2c3ccccc3c3c4oc5ccccc5c4ccc32)c(-n2c3ccc(C)cc3c3cc(C)ccc32)c(C#N)c1-n1c2ccccc2c2c3oc4ccccc4c3ccc21 |
| InChI | InChI=1S/C72H44N6O2/c1-39-22-28-56-49(34-39)50-35-40(2)23-29-57(50)75(56)68-53(38-73)67(77-54-18-10-6-16-47(54)64-60(77)32-26-45-43-14-8-12-20-62(43)79-71(45)64)66(74-5)69(76-58-30-24-41(3)36-51(58)52-37-42(4)25-31-59(52)76)70(68)78-55-19-11-7-17-48(55)65-61(78)33-27-46-44-15-9-13-21-63(44)80-72(46)65/h6-37H,1-4H3 |
| InChIKey | OIVVPZYDWHQNPI-UHFFFAOYSA-N |
| XLogP | 19.53 |
| TPSA | 74.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1025.18 |
| LogP ≤ 5 | 19.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|