C70H40N6O2 — CID 156680222
2,5-di(carbazol-9-yl)-3-isocyano-4,6-bis(10-methyl-[1]benzofuro[2,3-b]carbazol-7-yl)benzonitrile (PubChem CID 156680222) has the molecular formula C70H40N6O2 and a molecular weight of 997.13 g/mol. Its IUPAC name is 2,5-di(carbazol-9-yl)-3-isocyano-4,6-bis(10-methyl-[1]benzofuro[2,3-b]carbazol-7-yl)benzonitrile.
| Compound Name | 2,5-di(carbazol-9-yl)-3-isocyano-4,6-bis(10-methyl-[1]benzofuro[2,3-b]carbazol-7-yl)benzonitrile |
|---|---|
| PubChem CID | 156680222 |
| Molecular Formula | C70H40N6O2 |
| Molecular Weight | 997.13 g/mol |
| Exact Mass | 996.32 |
| IUPAC Name | 2,5-di(carbazol-9-yl)-3-isocyano-4,6-bis(10-methyl-[1]benzofuro[2,3-b]carbazol-7-yl)benzonitrile |
| SMILES | [C-]#[N+]c1c(-n2c3ccccc3c3ccccc32)c(C#N)c(-n2c3ccc(C)cc3c3cc4c(cc32)oc2ccccc24)c(-n2c3ccccc3c3ccccc32)c1-n1c2ccc(C)cc2c2cc3c(cc21)oc1ccccc13 |
| InChI | InChI=1S/C70H40N6O2/c1-39-28-30-58-47(32-39)49-34-51-45-20-8-14-26-62(45)77-64(51)36-60(49)75(58)68-53(38-71)67(73-54-22-10-4-16-41(54)42-17-5-11-23-55(42)73)66(72-3)69(70(68)74-56-24-12-6-18-43(56)44-19-7-13-25-57(44)74)76-59-31-29-40(2)33-48(59)50-35-52-46-21-9-15-27-63(46)78-65(52)37-61(50)76/h4-37H,1-2H3 |
| InChIKey | NKYMOZIGYSBVBS-UHFFFAOYSA-N |
| XLogP | 18.91 |
| TPSA | 74.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 997.13 |
| LogP ≤ 5 | 18.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|