C33H27N3 — CID 140704996
5-tert-butyl-2-(7,7-dimethylindeno[2,1-b]carbazol-5-yl)-3-isocyanobenzonitrile (PubChem CID 140704996) has the molecular formula C33H27N3 and a molecular weight of 465.60 g/mol. Its IUPAC name is 5-tert-butyl-2-(7,7-dimethylindeno[2,1-b]carbazol-5-yl)-3-isocyanobenzonitrile.
| Compound Name | 5-tert-butyl-2-(7,7-dimethylindeno[2,1-b]carbazol-5-yl)-3-isocyanobenzonitrile |
|---|---|
| PubChem CID | 140704996 |
| Molecular Formula | C33H27N3 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | 5-tert-butyl-2-(7,7-dimethylindeno[2,1-b]carbazol-5-yl)-3-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1cc(C(C)(C)C)cc(C#N)c1-n1c2ccccc2c2cc3c(cc21)C(C)(C)c1ccccc1-3 |
| InChI | InChI=1S/C33H27N3/c1-32(2,3)21-15-20(19-34)31(28(16-21)35-6)36-29-14-10-8-12-23(29)25-17-24-22-11-7-9-13-26(22)33(4,5)27(24)18-30(25)36/h7-18H,1-5H3 |
| InChIKey | RRGDYHQXWJBTKS-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 33.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|