C47H31N3 — CID 140705031
2-(7,7-dimethylindeno[2,1-b]carbazol-5-yl)-5-(2,6-diphenylphenyl)-3-isocyanobenzonitrile (PubChem CID 140705031) has the molecular formula C47H31N3 and a molecular weight of 637.79 g/mol. Its IUPAC name is 2-(7,7-dimethylindeno[2,1-b]carbazol-5-yl)-5-(2,6-diphenylphenyl)-3-isocyanobenzonitrile.
| Compound Name | 2-(7,7-dimethylindeno[2,1-b]carbazol-5-yl)-5-(2,6-diphenylphenyl)-3-isocyanobenzonitrile |
|---|---|
| PubChem CID | 140705031 |
| Molecular Formula | C47H31N3 |
| Molecular Weight | 637.79 g/mol |
| Exact Mass | 637.25 |
| IUPAC Name | 2-(7,7-dimethylindeno[2,1-b]carbazol-5-yl)-5-(2,6-diphenylphenyl)-3-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1cc(-c2c(-c3ccccc3)cccc2-c2ccccc2)cc(C#N)c1-n1c2ccccc2c2cc3c(cc21)C(C)(C)c1ccccc1-3 |
| InChI | InChI=1S/C47H31N3/c1-47(2)40-23-12-10-19-36(40)38-27-39-37-20-11-13-24-43(37)50(44(39)28-41(38)47)46-33(29-48)25-32(26-42(46)49-3)45-34(30-15-6-4-7-16-30)21-14-22-35(45)31-17-8-5-9-18-31/h4-28H,1-2H3 |
| InChIKey | OZVAUCYZKNXDFN-UHFFFAOYSA-N |
| XLogP | 12.51 |
| TPSA | 33.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.79 |
| LogP ≤ 5 | 12.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|