C50H34N4 — CID 153462691
15-(2-carbazol-9-yl-4,6-diisocyanophenyl)-11,11,19,19-tetramethyl-15-azaheptacyclo[14.11.0.02,14.04,12.05,10.018,26.020,25]heptacosa-1(27),2,4(12),5,7,9,13,16,18(26),20,22,24-dodecaene (PubChem CID 153462691) has the molecular formula C50H34N4 and a molecular weight of 690.85 g/mol. Its IUPAC name is 15-(2-carbazol-9-yl-4,6-diisocyanophenyl)-11,11,19,19-tetramethyl-15-azaheptacyclo[14.11.0.02,14.04,12.05,10.018,26.020,25]heptacosa-1(27),2,4(12),5,7,9,13,16,18(26),20,22,24-dodecaene.
| Compound Name | 15-(2-carbazol-9-yl-4,6-diisocyanophenyl)-11,11,19,19-tetramethyl-15-azaheptacyclo[14.11.0.02,14.04,12.05,10.018,26.020,25]heptacosa-1(27),2,4(12),5,7,9,13,16,18(26),20,22,24-dodecaene |
|---|---|
| PubChem CID | 153462691 |
| Molecular Formula | C50H34N4 |
| Molecular Weight | 690.85 g/mol |
| Exact Mass | 690.28 |
| IUPAC Name | 15-(2-carbazol-9-yl-4,6-diisocyanophenyl)-11,11,19,19-tetramethyl-15-azaheptacyclo[14.11.0.02,14.04,12.05,10.018,26.020,25]heptacosa-1(27),2,4(12),5,7,9,13,16,18(26),20,22,24-dodecaene |
| SMILES | [C-]#[N+]c1cc([N+]#[C-])c(-n2c3cc4c(cc3c3cc5c(cc32)C(C)(C)c2ccccc2-5)-c2ccccc2C4(C)C)c(-n2c3ccccc3c3ccccc32)c1 |
| InChI | InChI=1S/C50H34N4/c1-49(2)38-19-11-7-15-30(38)34-25-36-37-26-35-31-16-8-12-20-39(31)50(3,4)41(35)28-46(37)54(45(36)27-40(34)49)48-42(52-6)23-29(51-5)24-47(48)53-43-21-13-9-17-32(43)33-18-10-14-22-44(33)53/h7-28H,1-4H3 |
| InChIKey | ZOZBOKOBHCSFRW-UHFFFAOYSA-N |
| XLogP | 13.59 |
| TPSA | 18.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.85 |
| LogP ≤ 5 | 13.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|