C34H19F5N2 — CID 140704997
5-[2-isocyano-6-(2,3,4,5,6-pentafluorophenyl)phenyl]-7,7-dimethylindeno[2,1-b]carbazole (PubChem CID 140704997) has the molecular formula C34H19F5N2 and a molecular weight of 550.53 g/mol. Its IUPAC name is 5-[2-isocyano-6-(2,3,4,5,6-pentafluorophenyl)phenyl]-7,7-dimethylindeno[2,1-b]carbazole.
| Compound Name | 5-[2-isocyano-6-(2,3,4,5,6-pentafluorophenyl)phenyl]-7,7-dimethylindeno[2,1-b]carbazole |
|---|---|
| PubChem CID | 140704997 |
| Molecular Formula | C34H19F5N2 |
| Molecular Weight | 550.53 g/mol |
| Exact Mass | 550.15 |
| IUPAC Name | 5-[2-isocyano-6-(2,3,4,5,6-pentafluorophenyl)phenyl]-7,7-dimethylindeno[2,1-b]carbazole |
| SMILES | [C-]#[N+]c1cccc(-c2c(F)c(F)c(F)c(F)c2F)c1-n1c2ccccc2c2cc3c(cc21)C(C)(C)c1ccccc1-3 |
| InChI | InChI=1S/C34H19F5N2/c1-34(2)22-12-6-4-9-17(22)20-15-21-18-10-5-7-14-25(18)41(26(21)16-23(20)34)33-19(11-8-13-24(33)40-3)27-28(35)30(37)32(39)31(38)29(27)36/h4-16H,1-2H3 |
| InChIKey | RCFWCBMQYTXZPJ-UHFFFAOYSA-N |
| XLogP | 10.00 |
| TPSA | 9.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.53 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|