C41H26FN3 — CID 140701599
5-(7,7-dimethylindeno[2,1-b]carbazol-5-yl)-2-fluoro-3-isocyano-4,6-diphenylbenzonitrile (PubChem CID 140701599) has the molecular formula C41H26FN3 and a molecular weight of 579.68 g/mol. Its IUPAC name is 5-(7,7-dimethylindeno[2,1-b]carbazol-5-yl)-2-fluoro-3-isocyano-4,6-diphenylbenzonitrile.
| Compound Name | 5-(7,7-dimethylindeno[2,1-b]carbazol-5-yl)-2-fluoro-3-isocyano-4,6-diphenylbenzonitrile |
|---|---|
| PubChem CID | 140701599 |
| Molecular Formula | C41H26FN3 |
| Molecular Weight | 579.68 g/mol |
| Exact Mass | 579.21 |
| IUPAC Name | 5-(7,7-dimethylindeno[2,1-b]carbazol-5-yl)-2-fluoro-3-isocyano-4,6-diphenylbenzonitrile |
| SMILES | [C-]#[N+]c1c(F)c(C#N)c(-c2ccccc2)c(-n2c3ccccc3c3cc4c(cc32)C(C)(C)c2ccccc2-4)c1-c1ccccc1 |
| InChI | InChI=1S/C41H26FN3/c1-41(2)32-20-12-10-18-27(32)29-22-30-28-19-11-13-21-34(28)45(35(30)23-33(29)41)40-36(25-14-6-4-7-15-25)31(24-43)38(42)39(44-3)37(40)26-16-8-5-9-17-26/h4-23H,1-2H3 |
| InChIKey | NUYGWRCKFNFIGW-UHFFFAOYSA-N |
| XLogP | 10.99 |
| TPSA | 33.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.68 |
| LogP ≤ 5 | 10.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|