C64H40N6 — CID 164819642
2,5-bis(4-cyanophenyl)-4,6-bis(7,7-dimethylindeno[2,1-b]carbazol-5-yl)benzene-1,3-dicarbonitrile (PubChem CID 164819642) has the molecular formula C64H40N6 and a molecular weight of 893.07 g/mol. Its IUPAC name is 2,5-bis(4-cyanophenyl)-4,6-bis(7,7-dimethylindeno[2,1-b]carbazol-5-yl)benzene-1,3-dicarbonitrile.
| Compound Name | 2,5-bis(4-cyanophenyl)-4,6-bis(7,7-dimethylindeno[2,1-b]carbazol-5-yl)benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 164819642 |
| Molecular Formula | C64H40N6 |
| Molecular Weight | 893.07 g/mol |
| Exact Mass | 892.33 |
| IUPAC Name | 2,5-bis(4-cyanophenyl)-4,6-bis(7,7-dimethylindeno[2,1-b]carbazol-5-yl)benzene-1,3-dicarbonitrile |
| SMILES | CC1(C)c2ccccc2-c2cc3c4ccccc4n(-c4c(C#N)c(-c5ccc(C#N)cc5)c(C#N)c(-n5c6ccccc6c6cc7c(cc65)C(C)(C)c5ccccc5-7)c4-c4ccc(C#N)cc4)c3cc21 |
| InChI | InChI=1S/C64H40N6/c1-63(2)51-17-9-5-13-41(51)45-29-47-43-15-7-11-19-55(43)69(57(47)31-53(45)63)61-49(35-67)59(39-25-21-37(33-65)22-26-39)50(36-68)62(60(61)40-27-23-38(34-66)24-28-40)70-56-20-12-8-16-44(56)48-30-46-42-14-6-10-18-52(42)64(3,4)54(46)32-58(48)70/h5-32H,1-4H3 |
| InChIKey | XZCSOASXLHIFBA-UHFFFAOYSA-N |
| XLogP | 15.31 |
| TPSA | 105.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 893.07 |
| LogP ≤ 5 | 15.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |