C41H27N3 — CID 118927771
2-(7,7-dimethylindeno[2,1-b]carbazol-5-yl)-4,6-diphenylbenzene-1,3-dicarbonitrile (PubChem CID 118927771) has the molecular formula C41H27N3 and a molecular weight of 561.69 g/mol. Its IUPAC name is 2-(7,7-dimethylindeno[2,1-b]carbazol-5-yl)-4,6-diphenylbenzene-1,3-dicarbonitrile.
| Compound Name | 2-(7,7-dimethylindeno[2,1-b]carbazol-5-yl)-4,6-diphenylbenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 118927771 |
| Molecular Formula | C41H27N3 |
| Molecular Weight | 561.69 g/mol |
| Exact Mass | 561.22 |
| IUPAC Name | 2-(7,7-dimethylindeno[2,1-b]carbazol-5-yl)-4,6-diphenylbenzene-1,3-dicarbonitrile |
| SMILES | CC1(C)c2ccccc2-c2cc3c4ccccc4n(-c4c(C#N)c(-c5ccccc5)cc(-c5ccccc5)c4C#N)c3cc21 |
| InChI | InChI=1S/C41H27N3/c1-41(2)36-19-11-9-17-28(36)32-22-33-29-18-10-12-20-38(29)44(39(33)23-37(32)41)40-34(24-42)30(26-13-5-3-6-14-26)21-31(35(40)25-43)27-15-7-4-8-16-27/h3-23H,1-2H3 |
| InChIKey | PNXIYDVKYWASPY-UHFFFAOYSA-N |
| XLogP | 10.17 |
| TPSA | 52.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.69 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |