C46H32N2 — CID 89024618
4-[16-(4-cyanophenyl)-12,12,20,20-tetramethyl-2-heptacyclo[15.11.0.03,15.05,13.06,11.019,27.021,26]octacosa-1,3,5(13),6,8,10,14,16,18,21,23,25,27-tridecaenyl]benzonitrile (PubChem CID 89024618) has the molecular formula C46H32N2 and a molecular weight of 612.78 g/mol. Its IUPAC name is 4-[16-(4-cyanophenyl)-12,12,20,20-tetramethyl-2-heptacyclo[15.11.0.03,15.05,13.06,11.019,27.021,26]octacosa-1,3,5(13),6,8,10,14,16,18,21,23,25,27-tridecaenyl]benzonitrile.
| Compound Name | 4-[16-(4-cyanophenyl)-12,12,20,20-tetramethyl-2-heptacyclo[15.11.0.03,15.05,13.06,11.019,27.021,26]octacosa-1,3,5(13),6,8,10,14,16,18,21,23,25,27-tridecaenyl]benzonitrile |
|---|---|
| PubChem CID | 89024618 |
| Molecular Formula | C46H32N2 |
| Molecular Weight | 612.78 g/mol |
| Exact Mass | 612.26 |
| IUPAC Name | 4-[16-(4-cyanophenyl)-12,12,20,20-tetramethyl-2-heptacyclo[15.11.0.03,15.05,13.06,11.019,27.021,26]octacosa-1,3,5(13),6,8,10,14,16,18,21,23,25,27-tridecaenyl]benzonitrile |
| SMILES | CC1(C)c2ccccc2-c2cc3c(-c4ccc(C#N)cc4)c4cc5c(cc4c(-c4ccc(C#N)cc4)c3cc21)C(C)(C)c1ccccc1-5 |
| InChI | InChI=1S/C46H32N2/c1-45(2)39-11-7-5-9-31(39)33-21-35-37(23-41(33)45)44(30-19-15-28(26-48)16-20-30)38-24-42-34(32-10-6-8-12-40(32)46(42,3)4)22-36(38)43(35)29-17-13-27(25-47)14-18-29/h5-24H,1-4H3 |
| InChIKey | JWCKATSMFLHFCD-UHFFFAOYSA-N |
| XLogP | 11.68 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.78 |
| LogP ≤ 5 | 11.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|