C74H50N4 — CID 154596877
2,5-bis(6-carbazol-9-yl-9,9-dimethylfluoren-3-yl)-4-isocyano-3,6-diphenylbenzonitrile (PubChem CID 154596877) has the molecular formula C74H50N4 and a molecular weight of 995.24 g/mol. Its IUPAC name is 2,5-bis(6-carbazol-9-yl-9,9-dimethylfluoren-3-yl)-4-isocyano-3,6-diphenylbenzonitrile.
| Compound Name | 2,5-bis(6-carbazol-9-yl-9,9-dimethylfluoren-3-yl)-4-isocyano-3,6-diphenylbenzonitrile |
|---|---|
| PubChem CID | 154596877 |
| Molecular Formula | C74H50N4 |
| Molecular Weight | 995.24 g/mol |
| Exact Mass | 994.40 |
| IUPAC Name | 2,5-bis(6-carbazol-9-yl-9,9-dimethylfluoren-3-yl)-4-isocyano-3,6-diphenylbenzonitrile |
| SMILES | [C-]#[N+]c1c(-c2ccccc2)c(-c2ccc3c(c2)-c2cc(-n4c5ccccc5c5ccccc54)ccc2C3(C)C)c(C#N)c(-c2ccccc2)c1-c1ccc2c(c1)-c1cc(-n3c4ccccc4c4ccccc43)ccc1C2(C)C |
| InChI | InChI=1S/C74H50N4/c1-73(2)60-36-32-47(40-55(60)57-42-49(34-38-62(57)73)77-64-28-16-12-24-51(64)52-25-13-17-29-65(52)77)69-59(44-75)68(45-20-8-6-9-21-45)71(72(76-5)70(69)46-22-10-7-11-23-46)48-33-37-61-56(41-48)58-43-50(35-39-63(58)74(61,3)4)78-66-30-18-14-26-53(66)54-27-15-19-31-67(54)78/h6-43H,1-4H3 |
| InChIKey | YUVIISOTMUDXSW-UHFFFAOYSA-N |
| XLogP | 19.58 |
| TPSA | 38.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 995.24 |
| LogP ≤ 5 | 19.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|