C48H29N5 — CID 140794194
3-(4-carbazol-9-yl-2-cyanophenyl)-6-(7,7-dimethylindeno[1,2-a]carbazol-12-yl)-2-isocyanobenzonitrile (PubChem CID 140794194) has the molecular formula C48H29N5 and a molecular weight of 675.80 g/mol. Its IUPAC name is 3-(4-carbazol-9-yl-2-cyanophenyl)-6-(7,7-dimethylindeno[1,2-a]carbazol-12-yl)-2-isocyanobenzonitrile.
| Compound Name | 3-(4-carbazol-9-yl-2-cyanophenyl)-6-(7,7-dimethylindeno[1,2-a]carbazol-12-yl)-2-isocyanobenzonitrile |
|---|---|
| PubChem CID | 140794194 |
| Molecular Formula | C48H29N5 |
| Molecular Weight | 675.80 g/mol |
| Exact Mass | 675.24 |
| IUPAC Name | 3-(4-carbazol-9-yl-2-cyanophenyl)-6-(7,7-dimethylindeno[1,2-a]carbazol-12-yl)-2-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1c(-c2ccc(-n3c4ccccc4c4ccccc43)cc2C#N)ccc(-n2c3ccccc3c3ccc4c(c32)-c2ccccc2C4(C)C)c1C#N |
| InChI | InChI=1S/C48H29N5/c1-48(2)39-16-8-4-15-37(39)45-40(48)24-22-36-34-14-7-11-19-43(34)53(47(36)45)44-25-23-35(46(51-3)38(44)28-50)31-21-20-30(26-29(31)27-49)52-41-17-9-5-12-32(41)33-13-6-10-18-42(33)52/h4-26H,1-2H3 |
| InChIKey | QQZIQFXWJMXULJ-UHFFFAOYSA-N |
| XLogP | 12.15 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.80 |
| LogP ≤ 5 | 12.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|