C45H28N4 — CID 153462649
5-benzo[c]carbazol-7-yl-2-(7,7-dimethylindeno[1,2-a]carbazol-12-yl)-4-isocyanobenzonitrile (PubChem CID 153462649) has the molecular formula C45H28N4 and a molecular weight of 624.75 g/mol. Its IUPAC name is 5-benzo[c]carbazol-7-yl-2-(7,7-dimethylindeno[1,2-a]carbazol-12-yl)-4-isocyanobenzonitrile.
| Compound Name | 5-benzo[c]carbazol-7-yl-2-(7,7-dimethylindeno[1,2-a]carbazol-12-yl)-4-isocyanobenzonitrile |
|---|---|
| PubChem CID | 153462649 |
| Molecular Formula | C45H28N4 |
| Molecular Weight | 624.75 g/mol |
| Exact Mass | 624.23 |
| IUPAC Name | 5-benzo[c]carbazol-7-yl-2-(7,7-dimethylindeno[1,2-a]carbazol-12-yl)-4-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1cc(-n2c3ccccc3c3ccc4c(c32)-c2ccccc2C4(C)C)c(C#N)cc1-n1c2ccccc2c2c3ccccc3ccc21 |
| InChI | InChI=1S/C45H28N4/c1-45(2)34-17-9-6-15-32(34)43-35(45)22-21-31-30-14-7-10-18-37(30)49(44(31)43)40-25-36(47-3)41(24-28(40)26-46)48-38-19-11-8-16-33(38)42-29-13-5-4-12-27(29)20-23-39(42)48/h4-25H,1-2H3 |
| InChIKey | GFQMJROIONARGM-UHFFFAOYSA-N |
| XLogP | 11.76 |
| TPSA | 38.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.75 |
| LogP ≤ 5 | 11.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|