C57H37N5 — CID 153462131
5-(12,12-dimethylindeno[2,1-a]carbazol-11-yl)-4-isocyano-2-[10-(N-phenylanilino)benzo[c]carbazol-7-yl]benzonitrile (PubChem CID 153462131) has the molecular formula C57H37N5 and a molecular weight of 791.96 g/mol. Its IUPAC name is 5-(12,12-dimethylindeno[2,1-a]carbazol-11-yl)-4-isocyano-2-[10-(N-phenylanilino)benzo[c]carbazol-7-yl]benzonitrile.
| Compound Name | 5-(12,12-dimethylindeno[2,1-a]carbazol-11-yl)-4-isocyano-2-[10-(N-phenylanilino)benzo[c]carbazol-7-yl]benzonitrile |
|---|---|
| PubChem CID | 153462131 |
| Molecular Formula | C57H37N5 |
| Molecular Weight | 791.96 g/mol |
| Exact Mass | 791.30 |
| IUPAC Name | 5-(12,12-dimethylindeno[2,1-a]carbazol-11-yl)-4-isocyano-2-[10-(N-phenylanilino)benzo[c]carbazol-7-yl]benzonitrile |
| SMILES | [C-]#[N+]c1cc(-n2c3ccc(N(c4ccccc4)c4ccccc4)cc3c3c4ccccc4ccc32)c(C#N)cc1-n1c2ccccc2c2ccc3c(c21)C(C)(C)c1ccccc1-3 |
| InChI | InChI=1S/C57H37N5/c1-57(2)47-24-14-12-22-42(47)44-28-29-45-43-23-13-15-25-49(43)62(56(45)55(44)57)53-32-37(35-58)52(34-48(53)59-3)61-50-31-27-40(60(38-17-6-4-7-18-38)39-19-8-5-9-20-39)33-46(50)54-41-21-11-10-16-36(41)26-30-51(54)61/h4-34H,1-2H3 |
| InChIKey | KCNIMJTXGLCNPT-UHFFFAOYSA-N |
| XLogP | 15.23 |
| TPSA | 41.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.96 |
| LogP ≤ 5 | 15.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|