C48H29N5 — CID 153462687
5-carbazol-9-yl-4-isocyano-2-[10-(N-phenylanilino)benzo[c]carbazol-7-yl]benzonitrile (PubChem CID 153462687) has the molecular formula C48H29N5 and a molecular weight of 675.80 g/mol. Its IUPAC name is 5-carbazol-9-yl-4-isocyano-2-[10-(N-phenylanilino)benzo[c]carbazol-7-yl]benzonitrile.
| Compound Name | 5-carbazol-9-yl-4-isocyano-2-[10-(N-phenylanilino)benzo[c]carbazol-7-yl]benzonitrile |
|---|---|
| PubChem CID | 153462687 |
| Molecular Formula | C48H29N5 |
| Molecular Weight | 675.80 g/mol |
| Exact Mass | 675.24 |
| IUPAC Name | 5-carbazol-9-yl-4-isocyano-2-[10-(N-phenylanilino)benzo[c]carbazol-7-yl]benzonitrile |
| SMILES | [C-]#[N+]c1cc(-n2c3ccc(N(c4ccccc4)c4ccccc4)cc3c3c4ccccc4ccc32)c(C#N)cc1-n1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C48H29N5/c1-50-41-30-46(33(31-49)28-47(41)52-42-22-12-10-20-38(42)39-21-11-13-23-43(39)52)53-44-27-25-36(51(34-15-4-2-5-16-34)35-17-6-3-7-18-35)29-40(44)48-37-19-9-8-14-32(37)24-26-45(48)53/h2-30H |
| InChIKey | NNCQOKXYPUADNV-UHFFFAOYSA-N |
| XLogP | 12.93 |
| TPSA | 41.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.80 |
| LogP ≤ 5 | 12.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|