C58H38N4 — CID 153462171
2,5-bis(12,12-dimethyl-16-azahexacyclo[11.11.0.02,11.03,8.015,23.017,22]tetracosa-1(13),2(11),3,5,7,9,14,17,19,21,23-undecaen-16-yl)-4-isocyanobenzonitrile (PubChem CID 153462171) has the molecular formula C58H38N4 and a molecular weight of 790.97 g/mol. Its IUPAC name is 2,5-bis(12,12-dimethyl-16-azahexacyclo[11.11.0.02,11.03,8.015,23.017,22]tetracosa-1(13),2(11),3,5,7,9,14,17,19,21,23-undecaen-16-yl)-4-isocyanobenzonitrile.
| Compound Name | 2,5-bis(12,12-dimethyl-16-azahexacyclo[11.11.0.02,11.03,8.015,23.017,22]tetracosa-1(13),2(11),3,5,7,9,14,17,19,21,23-undecaen-16-yl)-4-isocyanobenzonitrile |
|---|---|
| PubChem CID | 153462171 |
| Molecular Formula | C58H38N4 |
| Molecular Weight | 790.97 g/mol |
| Exact Mass | 790.31 |
| IUPAC Name | 2,5-bis(12,12-dimethyl-16-azahexacyclo[11.11.0.02,11.03,8.015,23.017,22]tetracosa-1(13),2(11),3,5,7,9,14,17,19,21,23-undecaen-16-yl)-4-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1cc(-n2c3ccccc3c3cc4c(cc32)C(C)(C)c2ccc3ccccc3c2-4)c(C#N)cc1-n1c2ccccc2c2cc3c(cc21)C(C)(C)c1ccc2ccccc2c1-3 |
| InChI | InChI=1S/C58H38N4/c1-57(2)44-24-22-33-14-6-8-16-36(33)55(44)42-27-40-38-18-10-12-20-49(38)61(52(40)29-46(42)57)51-31-48(60-5)54(26-35(51)32-59)62-50-21-13-11-19-39(50)41-28-43-47(30-53(41)62)58(3,4)45-25-23-34-15-7-9-17-37(34)56(43)45/h6-31H,1-4H3 |
| InChIKey | KTERTXNYMUWKLW-UHFFFAOYSA-N |
| XLogP | 15.22 |
| TPSA | 38.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.97 |
| LogP ≤ 5 | 15.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|