C29H19N3 — CID 140705041
2-(11,11-dimethylindeno[1,2-b]carbazol-5-yl)-3-isocyanobenzonitrile (PubChem CID 140705041) has the molecular formula C29H19N3 and a molecular weight of 409.49 g/mol. Its IUPAC name is 2-(11,11-dimethylindeno[1,2-b]carbazol-5-yl)-3-isocyanobenzonitrile.
| Compound Name | 2-(11,11-dimethylindeno[1,2-b]carbazol-5-yl)-3-isocyanobenzonitrile |
|---|---|
| PubChem CID | 140705041 |
| Molecular Formula | C29H19N3 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 2-(11,11-dimethylindeno[1,2-b]carbazol-5-yl)-3-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1cccc(C#N)c1-n1c2ccccc2c2cc3c(cc21)-c1ccccc1C3(C)C |
| InChI | InChI=1S/C29H19N3/c1-29(2)23-12-6-4-10-19(23)21-16-27-22(15-24(21)29)20-11-5-7-14-26(20)32(27)28-18(17-30)9-8-13-25(28)31-3/h4-16H,1-2H3 |
| InChIKey | WZHXZNVZIKVVTI-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 33.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|